C17H30N4O — CID 59025410
(3aR,7aR)-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one (PubChem CID 59025410) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is (3aR,7aR)-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one.
| Compound Name | (3aR,7aR)-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 59025410 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | (3aR,7aR)-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
| SMILES | O=C1N[C@@H]2CCCC[C@H]2N1C1CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C17H30N4O/c22-17-19-15-3-1-2-4-16(15)21(17)14-7-11-20(12-8-14)13-5-9-18-10-6-13/h13-16,18H,1-12H2,(H,19,22)/t15-,16-/m1/s1 |
| InChIKey | YKYIFBPVNIHHID-HZPDHXFCSA-N |
| XLogP | 1.54 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |