C23H38N4O2 — CID 24882938
(3aS,7aS)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one (PubChem CID 24882938) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is (3aS,7aS)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one.
| Compound Name | (3aS,7aS)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 24882938 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (3aS,7aS)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
| SMILES | O=C(C1CCCC1)N1CCC(N2CCC(N3C(=O)N[C@H]4CCCC[C@@H]43)CC2)CC1 |
| InChI | InChI=1S/C23H38N4O2/c28-22(17-5-1-2-6-17)26-15-9-18(10-16-26)25-13-11-19(12-14-25)27-21-8-4-3-7-20(21)24-23(27)29/h17-21H,1-16H2,(H,24,29)/t20-,21-/m0/s1 |
| InChIKey | HFTYBVTZIUWPKC-SFTDATJTSA-N |
| XLogP | 2.97 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |