C27H43N3O2 — CID 163440140
(1R,3aR)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-1,1a-dimethyl-1,3a,4,5,6,7-hexahydrocyclopropa[c]indol-2-one (PubChem CID 163440140) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is (1R,3aR)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-1,1a-dimethyl-1,3a,4,5,6,7-hexahydrocyclopropa[c]indol-2-one.
| Compound Name | (1R,3aR)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-1,1a-dimethyl-1,3a,4,5,6,7-hexahydrocyclopropa[c]indol-2-one |
|---|---|
| PubChem CID | 163440140 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | (1R,3aR)-3-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]piperidin-4-yl]-1,1a-dimethyl-1,3a,4,5,6,7-hexahydrocyclopropa[c]indol-2-one |
| SMILES | C[C@H]1C2(C)C(=O)N(C3CCN(C4CCN(C(=O)C5CCCC5)CC4)CC3)[C@@H]3CCCCC312 |
| InChI | InChI=1S/C27H43N3O2/c1-19-26(2)25(32)30(23-9-5-6-14-27(19,23)26)22-12-15-28(16-13-22)21-10-17-29(18-11-21)24(31)20-7-3-4-8-20/h19-23H,3-18H2,1-2H3/t19-,23+,26?,27?/m0/s1 |
| InChIKey | AXVADOLUOLLZEO-PZNHHYKDSA-N |
| XLogP | 4.06 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |