C13H24N2 — CID 82750918
1-piperidin-4-yl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 82750918) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-piperidin-4-yl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-piperidin-4-yl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 82750918 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-piperidin-4-yl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | C1CCC2C(C1)CCN2C1CCNCC1 |
| InChI | InChI=1S/C13H24N2/c1-2-4-13-11(3-1)7-10-15(13)12-5-8-14-9-6-12/h11-14H,1-10H2 |
| InChIKey | RCSAJHKMEBSVPM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |