C15H28N2 — CID 100898605
(4aS,8aR)-1-(1-methylpiperidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 100898605) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (4aS,8aR)-1-(1-methylpiperidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aS,8aR)-1-(1-methylpiperidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 100898605 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (4aS,8aR)-1-(1-methylpiperidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CN1CCC(N2CCC[C@@H]3CCCC[C@H]32)CC1 |
| InChI | InChI=1S/C15H28N2/c1-16-11-8-14(9-12-16)17-10-4-6-13-5-2-3-7-15(13)17/h13-15H,2-12H2,1H3/t13-,15+/m0/s1 |
| InChIKey | MGESHONGICXGSQ-DZGCQCFKSA-N |
| XLogP | 2.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |