C19H35N3 — CID 124757728
(1R,8aR)-1-cyclohexyl-2-(1-methylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 124757728) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is (1R,8aR)-1-cyclohexyl-2-(1-methylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1R,8aR)-1-cyclohexyl-2-(1-methylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124757728 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | (1R,8aR)-1-cyclohexyl-2-(1-methylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CN1CCC(N2CCN3CCC[C@@H]3[C@H]2C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H35N3/c1-20-12-9-17(10-13-20)22-15-14-21-11-5-8-18(21)19(22)16-6-3-2-4-7-16/h16-19H,2-15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | WYGYCTLJQPBISB-RTBURBONSA-N |
| XLogP | 2.81 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |