C19H34N2 — CID 10379489
1,2-dicyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 10379489) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 1,2-dicyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 1,2-dicyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 10379489 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 1,2-dicyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C1CCC(C2C3CCCN3CCN2C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H34N2/c1-3-8-16(9-4-1)19-18-12-7-13-20(18)14-15-21(19)17-10-5-2-6-11-17/h16-19H,1-15H2 |
| InChIKey | AIFNPIRVPOJNEN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |