C21H38N2 — CID 6555286
(1R,8aR)-1-cyclohexyl-2-(4-ethylcyclohexyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 6555286) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is (1R,8aR)-1-cyclohexyl-2-(4-ethylcyclohexyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1R,8aR)-1-cyclohexyl-2-(4-ethylcyclohexyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 6555286 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | (1R,8aR)-1-cyclohexyl-2-(4-ethylcyclohexyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCC1CCC(N2CCN3CCC[C@@H]3[C@H]2C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H38N2/c1-2-17-10-12-19(13-11-17)23-16-15-22-14-6-9-20(22)21(23)18-7-4-3-5-8-18/h17-21H,2-16H2,1H3/t17?,19?,20-,21-/m1/s1 |
| InChIKey | DGZHQCBZSBQFIX-CGNZLSCGSA-N |
| XLogP | 4.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |