C23H39N3O3 — CID 123477221
tert-butyl 4-[4-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 123477221) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123477221 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | tert-butyl 4-[4-[(3aS,7aS)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCC(N3C(=O)C[C@@H]4CCCC[C@@H]43)CC2)CC1 |
| InChI | InChI=1S/C23H39N3O3/c1-23(2,3)29-22(28)25-14-8-18(9-15-25)24-12-10-19(11-13-24)26-20-7-5-4-6-17(20)16-21(26)27/h17-20H,4-16H2,1-3H3/t17-,20-/m0/s1 |
| InChIKey | CKJBBTBYAUPBMU-PXNSSMCTSA-N |
| XLogP | 3.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |