About tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride
tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride (PubChem CID 68579096) has the molecular formula C14H29Cl2N3O2
and a molecular weight of 342.31 g/mol. Its IUPAC name is tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride |
| PubChem CID | 68579096 |
| Molecular Formula | C14H29Cl2N3O2 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCNCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H27N3O2.2ClH/c1-14(2,3)19-13(18)17-8-4-12(5-9-17)16-10-6-15-7-11-16;;/h12,15H,4-11H2,1-3H3;2*1H |
| InChIKey | PXPCBHRRFNJKCY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride?
The IUPAC name of tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride (CID 68579096) is tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride.
What is the SMILES notation for tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride?
The canonical SMILES for tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride is CC(C)(C)OC(=O)N1CCC(N2CCNCC2)CC1.Cl.Cl.
What is the InChIKey of tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride?
The InChIKey is PXPCBHRRFNJKCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O2.2ClH/c1-14(2,3)19-13(18)17-8-4-12(5-9-17)16-10-6-15-7-11-16;;/h12,15H,4-11H2,1-3H3;2*1H.
What are the key properties of tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride?
tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride has a molecular weight of 342.31 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-piperazin-1-ylpiperidine-1-carboxylate;dihydrochloride is sourced from PubChem (CID 68579096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).