C15H29N2O3P — CID 67052687
tert-butyl 4-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)piperidine-1-carboxylate (PubChem CID 67052687) has the molecular formula C15H29N2O3P and a molecular weight of 316.38 g/mol. Its IUPAC name is tert-butyl 4-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67052687 |
| Molecular Formula | C15H29N2O3P |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl 4-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCP(C)(=O)CC2)CC1 |
| InChI | InChI=1S/C15H29N2O3P/c1-15(2,3)20-14(18)17-7-5-13(6-8-17)16-9-11-21(4,19)12-10-16/h13H,5-12H2,1-4H3 |
| InChIKey | JDTYKPXDIDAIPP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|