C20H37N3O4S — CID 167801897
tert-butyl 4-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpiperidine-1-carboxylate (PubChem CID 167801897) has the molecular formula C20H37N3O4S and a molecular weight of 415.60 g/mol. Its IUPAC name is tert-butyl 4-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167801897 |
| Molecular Formula | C20H37N3O4S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl 4-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)N2CCC(N3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C20H37N3O4S/c1-20(2,3)27-19(24)22-13-9-18(10-14-22)28(25,26)23-15-7-17(8-16-23)21-11-5-4-6-12-21/h17-18H,4-16H2,1-3H3 |
| InChIKey | HZIALTBVPPQJGF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |