C31H52N4O4 — CID 161124344
(7aR)-1-piperidin-4-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one;tert-butyl 4-[(7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidine-1-carboxylate (PubChem CID 161124344) has the molecular formula C31H52N4O4 and a molecular weight of 544.78 g/mol. Its IUPAC name is (7aR)-1-piperidin-4-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one;tert-butyl 4-[(7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidine-1-carboxylate.
| Compound Name | (7aR)-1-piperidin-4-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one;tert-butyl 4-[(7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161124344 |
| Molecular Formula | C31H52N4O4 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | (7aR)-1-piperidin-4-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one;tert-butyl 4-[(7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-indol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2C(=O)CC3CCCC[C@H]32)CC1.O=C1CC2CCCC[C@H]2N1C1CCNCC1 |
| InChI | InChI=1S/C18H30N2O3.C13H22N2O/c1-18(2,3)23-17(22)19-10-8-14(9-11-19)20-15-7-5-4-6-13(15)12-16(20)21;16-13-9-10-3-1-2-4-12(10)15(13)11-5-7-14-8-6-11/h13-15H,4-12H2,1-3H3;10-12,14H,1-9H2/t13?,15-;10?,12-/m11/s1 |
| InChIKey | ULJALSMNUSWMCE-NHFSWBFTSA-N |
| XLogP | 4.71 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |