C16H27N3O2 — CID 97134929
(7R)-7-cyclohexyl-4-piperidin-4-yl-1,4-diazepane-2,5-dione (PubChem CID 97134929) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is (7R)-7-cyclohexyl-4-piperidin-4-yl-1,4-diazepane-2,5-dione.
| Compound Name | (7R)-7-cyclohexyl-4-piperidin-4-yl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 97134929 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (7R)-7-cyclohexyl-4-piperidin-4-yl-1,4-diazepane-2,5-dione |
| SMILES | O=C1CN(C2CCNCC2)C(=O)C[C@H](C2CCCCC2)N1 |
| InChI | InChI=1S/C16H27N3O2/c20-15-11-19(13-6-8-17-9-7-13)16(21)10-14(18-15)12-4-2-1-3-5-12/h12-14,17H,1-11H2,(H,18,20)/t14-/m1/s1 |
| InChIKey | KYTUYIBEQRZBLO-CQSZACIVSA-N |
| XLogP | 1.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |