C17H22N2O3S — CID 42958612
5,5-dioxo-1-(4-piperidin-1-ylphenyl)-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one (PubChem CID 42958612) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 5,5-dioxo-1-(4-piperidin-1-ylphenyl)-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one.
| Compound Name | 5,5-dioxo-1-(4-piperidin-1-ylphenyl)-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 42958612 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5,5-dioxo-1-(4-piperidin-1-ylphenyl)-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
| SMILES | O=C1CC2CS(=O)(=O)CC2N1c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H22N2O3S/c20-17-10-13-11-23(21,22)12-16(13)19(17)15-6-4-14(5-7-15)18-8-2-1-3-9-18/h4-7,13,16H,1-3,8-12H2 |
| InChIKey | GABOCHVIUCDURK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|