C17H18N2O3S2 — CID 42958604
1-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one (PubChem CID 42958604) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one.
| Compound Name | 1-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 42958604 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
| SMILES | CCc1ccc(-c2csc(N3C(=O)CC4CS(=O)(=O)CC43)n2)cc1 |
| InChI | InChI=1S/C17H18N2O3S2/c1-2-11-3-5-12(6-4-11)14-8-23-17(18-14)19-15-10-24(21,22)9-13(15)7-16(19)20/h3-6,8,13,15H,2,7,9-10H2,1H3 |
| InChIKey | TVEVMZGAHUEBOO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |