C13H9ClN2O4S2 — CID 76685244
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,1-dioxo-1,4-thiazinane-3,5-dione (PubChem CID 76685244) has the molecular formula C13H9ClN2O4S2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,1-dioxo-1,4-thiazinane-3,5-dione.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,1-dioxo-1,4-thiazinane-3,5-dione |
|---|---|
| PubChem CID | 76685244 |
| Molecular Formula | C13H9ClN2O4S2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,1-dioxo-1,4-thiazinane-3,5-dione |
| SMILES | O=C1CS(=O)(=O)CC(=O)N1c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C13H9ClN2O4S2/c14-9-3-1-8(2-4-9)10-5-21-13(15-10)16-11(17)6-22(19,20)7-12(16)18/h1-5H,6-7H2 |
| InChIKey | VBBVQLLIUPDPMB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|