C14H12ClN2O2S- — CID 6577339
(2R)-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxylate (PubChem CID 6577339) has the molecular formula C14H12ClN2O2S- and a molecular weight of 307.78 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6577339 |
| Molecular Formula | C14H12ClN2O2S- |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (2R)-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN1c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C14H13ClN2O2S/c15-10-5-3-9(4-6-10)11-8-20-14(16-11)17-7-1-2-12(17)13(18)19/h3-6,8,12H,1-2,7H2,(H,18,19)/p-1/t12-/m1/s1 |
| InChIKey | PMOVHFBTDLEVDP-GFCCVEGCSA-M |
| XLogP | 2.18 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |