C16H18ClN3S — CID 565978
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(4-chlorophenyl)-1,3-thiazole (PubChem CID 565978) has the molecular formula C16H18ClN3S and a molecular weight of 319.86 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(4-chlorophenyl)-1,3-thiazole.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(4-chlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 565978 |
| Molecular Formula | C16H18ClN3S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(4-chlorophenyl)-1,3-thiazole |
| SMILES | Clc1ccc(-c2csc(N3CCN4CCCC4C3)n2)cc1 |
| InChI | InChI=1S/C16H18ClN3S/c17-13-5-3-12(4-6-13)15-11-21-16(18-15)20-9-8-19-7-1-2-14(19)10-20/h3-6,11,14H,1-2,7-10H2 |
| InChIKey | OEVKPPCAYSTFIC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |