C20H25ClN4S2 — CID 3223728
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclohexylpiperazine-1-carbothioamide (PubChem CID 3223728) has the molecular formula C20H25ClN4S2 and a molecular weight of 421.04 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclohexylpiperazine-1-carbothioamide.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclohexylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3223728 |
| Molecular Formula | C20H25ClN4S2 |
| Molecular Weight | 421.04 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclohexylpiperazine-1-carbothioamide |
| SMILES | S=C(NC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)cs2)CC1 |
| InChI | InChI=1S/C20H25ClN4S2/c21-16-8-6-15(7-9-16)18-14-27-20(23-18)25-12-10-24(11-13-25)19(26)22-17-4-2-1-3-5-17/h6-9,14,17H,1-5,10-13H2,(H,22,26) |
| InChIKey | MPFMISXLJKAFSS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.04 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|