C21H28N4OS2 — CID 1447665
N-cyclohexyl-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide (PubChem CID 1447665) has the molecular formula C21H28N4OS2 and a molecular weight of 416.62 g/mol. Its IUPAC name is N-cyclohexyl-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1447665 |
| Molecular Formula | C21H28N4OS2 |
| Molecular Weight | 416.62 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-cyclohexyl-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
| SMILES | COc1cccc(-c2csc(N3CCN(C(=S)NC4CCCCC4)CC3)n2)c1 |
| InChI | InChI=1S/C21H28N4OS2/c1-26-18-9-5-6-16(14-18)19-15-28-21(23-19)25-12-10-24(11-13-25)20(27)22-17-7-3-2-4-8-17/h5-6,9,14-15,17H,2-4,7-8,10-13H2,1H3,(H,22,27) |
| InChIKey | IWHMNDZOOKFUKX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|