C23H24Cl2N4OS2 — CID 3861090
N-cyclopentyl-4-[4-[3-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide (PubChem CID 3861090) has the molecular formula C23H24Cl2N4OS2 and a molecular weight of 507.51 g/mol. Its IUPAC name is N-cyclopentyl-4-[4-[3-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-cyclopentyl-4-[4-[3-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3861090 |
| Molecular Formula | C23H24Cl2N4OS2 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-cyclopentyl-4-[4-[3-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide |
| SMILES | S=C(NC1CCCC1)N1CCC(c2nc(-c3cc(-c4ccc(Cl)c(Cl)c4)no3)cs2)CC1 |
| InChI | InChI=1S/C23H24Cl2N4OS2/c24-17-6-5-15(11-18(17)25)19-12-21(30-28-19)20-13-32-22(27-20)14-7-9-29(10-8-14)23(31)26-16-3-1-2-4-16/h5-6,11-14,16H,1-4,7-10H2,(H,26,31) |
| InChIKey | UKEIJHUWJGCGFJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|