C14H16N2OS — CID 133371791
[(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol (PubChem CID 133371791) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 133371791 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H16N2OS/c17-9-12-7-4-8-16(12)14-15-13(10-18-14)11-5-2-1-3-6-11/h1-3,5-6,10,12,17H,4,7-9H2/t12-/m0/s1 |
| InChIKey | SMRGVNRXAMMWKT-LBPRGKRZSA-N |
| XLogP | 2.77 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |