About [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol
[(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol (PubChem CID 133371791) has the molecular formula C14H16N2OS
and a molecular weight of 260.36 g/mol. Its IUPAC name is [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol |
| PubChem CID | 133371791 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H16N2OS/c17-9-12-7-4-8-16(12)14-15-13(10-18-14)11-5-2-1-3-6-11/h1-3,5-6,10,12,17H,4,7-9H2/t12-/m0/s1 |
| InChIKey | SMRGVNRXAMMWKT-LBPRGKRZSA-N |
| XLogP | 2.77 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol?
The IUPAC name of [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol (CID 133371791) is [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol is OC[C@@H]1CCCN1c1nc(-c2ccccc2)cs1.
What is the InChIKey of [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol?
The InChIKey is SMRGVNRXAMMWKT-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H16N2OS/c17-9-12-7-4-8-16(12)14-15-13(10-18-14)11-5-2-1-3-6-11/h1-3,5-6,10,12,17H,4,7-9H2/t12-/m0/s1.
What are the key properties of [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol?
[(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol has a molecular weight of 260.36 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 133371791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).