C12H10N4OS — CID 82221219
[1-(4-phenyl-1,3-thiazol-2-yl)triazol-4-yl]methanol (PubChem CID 82221219) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is [1-(4-phenyl-1,3-thiazol-2-yl)triazol-4-yl]methanol.
| Compound Name | [1-(4-phenyl-1,3-thiazol-2-yl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 82221219 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | [1-(4-phenyl-1,3-thiazol-2-yl)triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2nc(-c3ccccc3)cs2)nn1 |
| InChI | InChI=1S/C12H10N4OS/c17-7-10-6-16(15-14-10)12-13-11(8-18-12)9-4-2-1-3-5-9/h1-6,8,17H,7H2 |
| InChIKey | UQOYLXXZJPZZFJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |