2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid

C16H18N2O2S — CID 61009837

IUPAC2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid
SMILESO=C(O)CC1CCCCN1c1nc(-c2ccccc2)cs1
InChIInChI=1S/C16H18N2O2S/c19-15(20)10-13-8-4-5-9-18(13)16-17-14(11-21-16)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10H2,(H,19,20)
InChIKeyXWIHBRBHRLOCHF-UHFFFAOYSA-N
MW302.40 g/mol
LogP3.64
Rot. Bonds4

About 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid

2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid (PubChem CID 61009837) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid
PubChem CID61009837
Molecular FormulaC16H18N2O2S
Molecular Weight302.40 g/mol
Exact Mass302.11
IUPAC Name2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid
SMILESO=C(O)CC1CCCCN1c1nc(-c2ccccc2)cs1
InChIInChI=1S/C16H18N2O2S/c19-15(20)10-13-8-4-5-9-18(13)16-17-14(11-21-16)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10H2,(H,19,20)
InChIKeyXWIHBRBHRLOCHF-UHFFFAOYSA-N
XLogP3.64
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.40
LogP ≤ 53.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid?
The IUPAC name of 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid (CID 61009837) is 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid.
What is the SMILES notation for 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid?
The canonical SMILES for 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid is O=C(O)CC1CCCCN1c1nc(-c2ccccc2)cs1.
What is the InChIKey of 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid?
The InChIKey is XWIHBRBHRLOCHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c19-15(20)10-13-8-4-5-9-18(13)16-17-14(11-21-16)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10H2,(H,19,20).
What are the key properties of 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid?
2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid has a molecular weight of 302.40 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-2-yl]acetic acid is sourced from PubChem (CID 61009837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).