C15H13ClN2O3S2 — CID 42958931
1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one (PubChem CID 42958931) has the molecular formula C15H13ClN2O3S2 and a molecular weight of 368.87 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one.
| Compound Name | 1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 42958931 |
| Molecular Formula | C15H13ClN2O3S2 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
| SMILES | O=C1CC2CS(=O)(=O)CC2N1c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C15H13ClN2O3S2/c16-11-3-1-9(2-4-11)12-6-22-15(17-12)18-13-8-23(20,21)7-10(13)5-14(18)19/h1-4,6,10,13H,5,7-8H2 |
| InChIKey | PNTYSABPHIDOAA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |