C17H16ClN3O4S2 — CID 135924967
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-2H-pyrrol-3-ol (PubChem CID 135924967) has the molecular formula C17H16ClN3O4S2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135924967 |
| Molecular Formula | C17H16ClN3O4S2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1[C@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C17H16ClN3O4S2/c18-10-3-1-9(2-4-10)11-6-26-17(20-11)15-13(22)5-21(16(15)19)12-7-27(24,25)8-14(12)23/h1-4,6,12,14,19,22-23H,5,7-8H2/b19-16+/t12-,14-/m0/s1 |
| InChIKey | FLUXADHATCIBOK-JKWCJKDJSA-N |
| XLogP | 2.18 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|