C12H15N3O4S2 — CID 135904165
1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 135904165) has the molecular formula C12H15N3O4S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135904165 |
| Molecular Formula | C12H15N3O4S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C(c2nc(C)cs2)=C(O)CN1[C@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C12H15N3O4S2/c1-6-3-20-12(14-6)10-8(16)2-15(11(10)13)7-4-21(18,19)5-9(7)17/h3,7,9,13,16-17H,2,4-5H2,1H3/b13-11+/t7-,9-/m0/s1 |
| InChIKey | KVTYWLORCDIURV-PQIBRJNLSA-N |
| XLogP | 0.17 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|