C19H22N4OS — CID 136725566
5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol (PubChem CID 136725566) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725566 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C(c2nc(C)cs2)=C(O)CN1c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H22N4OS/c1-13-12-25-19(21-13)17-16(24)11-23(18(17)20)15-7-5-14(6-8-15)22-9-3-2-4-10-22/h5-8,12,20,24H,2-4,9-11H2,1H3/b20-18+ |
| InChIKey | HPCPAGOUAWVKQF-CZIZESTLSA-N |
| XLogP | 4.21 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|