C25H27N3OS — CID 136725474
1-(4-tert-butylphenyl)-4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol (PubChem CID 136725474) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-(4-tert-butylphenyl)-4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725474 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-(4-tert-butylphenyl)-4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(C)c(C)c3)cs2)=C(O)CN1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H27N3OS/c1-15-6-7-17(12-16(15)2)20-14-30-24(27-20)22-21(29)13-28(23(22)26)19-10-8-18(9-11-19)25(3,4)5/h6-12,14,26,29H,13H2,1-5H3/b26-23- |
| InChIKey | FPTHRLXOUMCLIR-RWEWTDSWSA-N |
| XLogP | 6.49 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|