C21H18FN3O2S — CID 135868985
1-(3-fluoro-4-methylphenyl)-5-imino-4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol (PubChem CID 135868985) has the molecular formula C21H18FN3O2S and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-5-imino-4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-5-imino-4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135868985 |
| Molecular Formula | C21H18FN3O2S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-5-imino-4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(OC)cc3)cs2)=C(O)CN1c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C21H18FN3O2S/c1-12-3-6-14(9-16(12)22)25-10-18(26)19(20(25)23)21-24-17(11-28-21)13-4-7-15(27-2)8-5-13/h3-9,11,23,26H,10H2,1-2H3/b23-20- |
| InChIKey | UNJXISYAWAXEDZ-ATJXCDBQSA-N |
| XLogP | 5.03 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|