C20H15F2N3O2S — CID 135859753
1-(3,4-difluorophenyl)-5-imino-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol (PubChem CID 135859753) has the molecular formula C20H15F2N3O2S and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-5-imino-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol.
| Compound Name | 1-(3,4-difluorophenyl)-5-imino-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135859753 |
| Molecular Formula | C20H15F2N3O2S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-(3,4-difluorophenyl)-5-imino-4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3cccc(OC)c3)cs2)=C(O)CN1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H15F2N3O2S/c1-27-13-4-2-3-11(7-13)16-10-28-20(24-16)18-17(26)9-25(19(18)23)12-5-6-14(21)15(22)8-12/h2-8,10,23,26H,9H2,1H3/b23-19- |
| InChIKey | FURSYUKKYLHJBV-NMWGTECJSA-N |
| XLogP | 4.86 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|