C26H21N3O2S — CID 136726022
5-imino-1-(3-phenylmethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 136726022) has the molecular formula C26H21N3O2S and a molecular weight of 439.54 g/mol. Its IUPAC name is 5-imino-1-(3-phenylmethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 5-imino-1-(3-phenylmethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136726022 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 5-imino-1-(3-phenylmethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)cs2)=C(O)CN1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H21N3O2S/c27-25-24(26-28-22(17-32-26)19-10-5-2-6-11-19)23(30)15-29(25)20-12-7-13-21(14-20)31-16-18-8-3-1-4-9-18/h1-14,17,27,30H,15-16H2/b27-25- |
| InChIKey | XANLIKGRDMYNEH-RFBIWTDZSA-N |
| XLogP | 6.16 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|