C21H17N3O2S — CID 135653145
1-[3-[3-hydroxy-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]phenyl]ethanone (PubChem CID 135653145) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-[3-[3-hydroxy-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-[3-hydroxy-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 135653145 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-[3-[3-hydroxy-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]phenyl]ethanone |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)cs2)=C(O)CN1c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C21H17N3O2S/c1-13(25)15-8-5-9-16(10-15)24-11-18(26)19(20(24)22)21-23-17(12-27-21)14-6-3-2-4-7-14/h2-10,12,22,26H,11H2,1H3/b22-20- |
| InChIKey | FMZIZDZGXVNYHC-XDOYNYLZSA-N |
| XLogP | 4.78 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|