C19H13Cl2N3OS — CID 136724940
1-(3,5-dichlorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 136724940) has the molecular formula C19H13Cl2N3OS and a molecular weight of 402.31 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-(3,5-dichlorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136724940 |
| Molecular Formula | C19H13Cl2N3OS |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)cs2)=C(O)CN1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H13Cl2N3OS/c20-12-6-13(21)8-14(7-12)24-9-16(25)17(18(24)22)19-23-15(10-26-19)11-4-2-1-3-5-11/h1-8,10,22,25H,9H2/b22-18- |
| InChIKey | YUOGFJGAHWNIMT-PYCFMQQDSA-N |
| XLogP | 5.88 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|