C25H19ClN4OS — CID 136725294
1-(4-anilinophenyl)-4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol (PubChem CID 136725294) has the molecular formula C25H19ClN4OS and a molecular weight of 458.97 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-(4-anilinophenyl)-4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725294 |
| Molecular Formula | C25H19ClN4OS |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 1-(4-anilinophenyl)-4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H19ClN4OS/c26-17-8-6-16(7-9-17)21-15-32-25(29-21)23-22(31)14-30(24(23)27)20-12-10-19(11-13-20)28-18-4-2-1-3-5-18/h1-13,15,27-28,31H,14H2/b27-24- |
| InChIKey | BPOKXPOZQMVCCG-PNHLSOANSA-N |
| XLogP | 6.97 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|