C24H22ClN3O3S — CID 136725265
propan-2-yl 2-[4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]acetate (PubChem CID 136725265) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is propan-2-yl 2-[4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]acetate.
| Compound Name | propan-2-yl 2-[4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 136725265 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | propan-2-yl 2-[4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]acetate |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1c1ccc(CC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C24H22ClN3O3S/c1-14(2)31-21(30)11-15-3-9-18(10-4-15)28-12-20(29)22(23(28)26)24-27-19(13-32-24)16-5-7-17(25)8-6-16/h3-10,13-14,26,29H,11-12H2,1-2H3/b26-23- |
| InChIKey | SNEZGZALCGGFEW-RWEWTDSWSA-N |
| XLogP | 5.72 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|