C22H19F2N3OS — CID 135869050
4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-propan-2-ylphenyl)-2H-pyrrol-3-ol (PubChem CID 135869050) has the molecular formula C22H19F2N3OS and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-propan-2-ylphenyl)-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-propan-2-ylphenyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135869050 |
| Molecular Formula | C22H19F2N3OS |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-propan-2-ylphenyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(F)c(F)c3)cs2)=C(O)CN1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H19F2N3OS/c1-12(2)13-3-6-15(7-4-13)27-10-19(28)20(21(27)25)22-26-18(11-29-22)14-5-8-16(23)17(24)9-14/h3-9,11-12,25,28H,10H2,1-2H3/b25-21- |
| InChIKey | HDSCNCITDMUMFM-DAFNUICNSA-N |
| XLogP | 5.98 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|