C24H23ClN4OS — CID 135507106
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol (PubChem CID 135507106) has the molecular formula C24H23ClN4OS and a molecular weight of 451.00 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135507106 |
| Molecular Formula | C24H23ClN4OS |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H23ClN4OS/c25-17-6-4-16(5-7-17)20-15-31-24(27-20)22-21(30)14-29(23(22)26)19-10-8-18(9-11-19)28-12-2-1-3-13-28/h4-11,15,26,30H,1-3,12-14H2/b26-23- |
| InChIKey | QNDUZTHZGPHFDO-RWEWTDSWSA-N |
| XLogP | 6.22 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|