C19H14FN3OS — CID 136652466
1-(4-fluorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 136652466) has the molecular formula C19H14FN3OS and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-(4-fluorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136652466 |
| Molecular Formula | C19H14FN3OS |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-(4-fluorophenyl)-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)cs2)=C(O)CN1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FN3OS/c20-13-6-8-14(9-7-13)23-10-16(24)17(18(23)21)19-22-15(11-25-19)12-4-2-1-3-5-12/h1-9,11,21,24H,10H2/b21-18- |
| InChIKey | YEWIWGLSKQUXJD-UZYVYHOESA-N |
| XLogP | 4.72 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|