C23H23FN4OS — CID 136725128
1-[4-(diethylamino)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol (PubChem CID 136725128) has the molecular formula C23H23FN4OS and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-[4-(diethylamino)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725128 |
| Molecular Formula | C23H23FN4OS |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(F)cc3)cs2)=C(O)CN1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H23FN4OS/c1-3-27(4-2)17-9-11-18(12-10-17)28-13-20(29)21(22(28)25)23-26-19(14-30-23)15-5-7-16(24)8-6-15/h5-12,14,25,29H,3-4,13H2,1-2H3/b25-22- |
| InChIKey | CGGRUNRDGUEHDB-LVWGJNHUSA-N |
| XLogP | 5.56 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|