C19H13ClFN3OS — CID 135872618
4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-(4-fluorophenyl)-5-imino-2H-pyrrol-3-ol (PubChem CID 135872618) has the molecular formula C19H13ClFN3OS and a molecular weight of 385.85 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-(4-fluorophenyl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-(4-fluorophenyl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135872618 |
| Molecular Formula | C19H13ClFN3OS |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-(4-fluorophenyl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3Cl)cs2)=C(O)CN1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13ClFN3OS/c20-14-4-2-1-3-13(14)15-10-26-19(23-15)17-16(25)9-24(18(17)22)12-7-5-11(21)6-8-12/h1-8,10,22,25H,9H2/b22-18- |
| InChIKey | WOBRFEJLAFNJQE-PYCFMQQDSA-N |
| XLogP | 5.37 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|