C24H22ClN3O3S — CID 136725269
butyl 4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate (PubChem CID 136725269) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is butyl 4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 136725269 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | butyl 4-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1c1ccc(C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C24H22ClN3O3S/c1-2-3-12-31-24(30)16-6-10-18(11-7-16)28-13-20(29)21(22(28)26)23-27-19(14-32-23)15-4-8-17(25)9-5-15/h4-11,14,26,29H,2-3,12-13H2,1H3/b26-22- |
| InChIKey | BGWDLUOCCJPJCB-ROMGYVFFSA-N |
| XLogP | 6.19 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|