C26H27N3O3S — CID 136725059
butyl 4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzoate (PubChem CID 136725059) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is butyl 4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 136725059 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | butyl 4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzoate |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(C)cc3)c(C)s2)=C(O)CN1c1ccc(C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-4-5-14-32-26(31)19-10-12-20(13-11-19)29-15-21(30)22(24(29)27)25-28-23(17(3)33-25)18-8-6-16(2)7-9-18/h6-13,27,30H,4-5,14-15H2,1-3H3/b27-24- |
| InChIKey | FPUZUUXAFQBAAZ-PNHLSOANSA-N |
| XLogP | 6.15 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|