C21H20N4O3S2 — CID 136725084
4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzenesulfonamide (PubChem CID 136725084) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 136725084 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-[3-hydroxy-5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]benzenesulfonamide |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(C)cc3)c(C)s2)=C(O)CN1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H20N4O3S2/c1-12-3-5-14(6-4-12)19-13(2)29-21(24-19)18-17(26)11-25(20(18)22)15-7-9-16(10-8-15)30(23,27)28/h3-10,22,26H,11H2,1-2H3,(H2,23,27,28)/b22-20- |
| InChIKey | LUMKFCUJPOWCPT-XDOYNYLZSA-N |
| XLogP | 3.84 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|