C21H19N3O2S — CID 136725940
1-(4-hydroxy-2-methylphenyl)-5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 136725940) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-(4-hydroxy-2-methylphenyl)-5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-(4-hydroxy-2-methylphenyl)-5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725940 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-(4-hydroxy-2-methylphenyl)-5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)c(C)s2)=C(O)CN1c1ccc(O)cc1C |
| InChI | InChI=1S/C21H19N3O2S/c1-12-10-15(25)8-9-16(12)24-11-17(26)18(20(24)22)21-23-19(13(2)27-21)14-6-4-3-5-7-14/h3-10,22,25-26H,11H2,1-2H3/b22-20- |
| InChIKey | JZGZAGZMQJWFML-XDOYNYLZSA-N |
| XLogP | 4.90 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|