C22H21N3OS — CID 136725048
5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-1-(3-methylphenyl)-2H-pyrrol-3-ol (PubChem CID 136725048) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-1-(3-methylphenyl)-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-1-(3-methylphenyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725048 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 5-imino-4-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-1-(3-methylphenyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(C)cc3)c(C)s2)=C(O)CN1c1cccc(C)c1 |
| InChI | InChI=1S/C22H21N3OS/c1-13-7-9-16(10-8-13)20-15(3)27-22(24-20)19-18(26)12-25(21(19)23)17-6-4-5-14(2)11-17/h4-11,23,26H,12H2,1-3H3/b23-21- |
| InChIKey | FVAYLFUGKAAZJF-LNVKXUELSA-N |
| XLogP | 5.50 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|