C26H28N4OS — CID 136725881
5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-1-[4-(4-methylpiperidin-1-yl)phenyl]-2H-pyrrol-3-ol (PubChem CID 136725881) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is 5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-1-[4-(4-methylpiperidin-1-yl)phenyl]-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-1-[4-(4-methylpiperidin-1-yl)phenyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725881 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 5-imino-4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-1-[4-(4-methylpiperidin-1-yl)phenyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)c(C)s2)=C(O)CN1c1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C26H28N4OS/c1-17-12-14-29(15-13-17)20-8-10-21(11-9-20)30-16-22(31)23(25(30)27)26-28-24(18(2)32-26)19-6-4-3-5-7-19/h3-11,17,27,31H,12-16H2,1-2H3/b27-25- |
| InChIKey | KAILZEJAPVLZTM-RFBIWTDZSA-N |
| XLogP | 6.12 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|