C22H21N3O2S — CID 136725508
4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-1-(4-hydroxy-2-methylphenyl)-5-imino-2H-pyrrol-3-ol (PubChem CID 136725508) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-1-(4-hydroxy-2-methylphenyl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-1-(4-hydroxy-2-methylphenyl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725508 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-1-(4-hydroxy-2-methylphenyl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(C)c(C)c3)cs2)=C(O)CN1c1ccc(O)cc1C |
| InChI | InChI=1S/C22H21N3O2S/c1-12-4-5-15(8-13(12)2)17-11-28-22(24-17)20-19(27)10-25(21(20)23)18-7-6-16(26)9-14(18)3/h4-9,11,23,26-27H,10H2,1-3H3/b23-21- |
| InChIKey | CENGCKNWENJUGX-LNVKXUELSA-N |
| XLogP | 5.21 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|