C16H14F3N3O2S — CID 136725643
4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-[4-(trifluoromethoxy)phenyl]-2H-pyrrol-3-ol (PubChem CID 136725643) has the molecular formula C16H14F3N3O2S and a molecular weight of 369.37 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-[4-(trifluoromethoxy)phenyl]-2H-pyrrol-3-ol.
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-[4-(trifluoromethoxy)phenyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725643 |
| Molecular Formula | C16H14F3N3O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-[4-(trifluoromethoxy)phenyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(C)c(C)s2)=C(O)CN1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3N3O2S/c1-8-9(2)25-15(21-8)13-12(23)7-22(14(13)20)10-3-5-11(6-4-10)24-16(17,18)19/h3-6,20,23H,7H2,1-2H3/b20-14- |
| InChIKey | XCEOHYKBQBTHGV-ZHZULCJRSA-N |
| XLogP | 4.43 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|